C19H18FN3O — CID 133369289
8-fluoro-2-methyl-4-(3-pyridin-3-yloxypyrrolidin-1-yl)quinoline (PubChem CID 133369289) has the molecular formula C19H18FN3O and a molecular weight of 323.37 g/mol. Its IUPAC name is 8-fluoro-2-methyl-4-(3-pyridin-3-yloxypyrrolidin-1-yl)quinoline.
| Compound Name | 8-fluoro-2-methyl-4-(3-pyridin-3-yloxypyrrolidin-1-yl)quinoline |
|---|---|
| PubChem CID | 133369289 |
| Molecular Formula | C19H18FN3O |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 8-fluoro-2-methyl-4-(3-pyridin-3-yloxypyrrolidin-1-yl)quinoline |
| SMILES | Cc1cc(N2CCC(Oc3cccnc3)C2)c2cccc(F)c2n1 |
| InChI | InChI=1S/C19H18FN3O/c1-13-10-18(16-5-2-6-17(20)19(16)22-13)23-9-7-15(12-23)24-14-4-3-8-21-11-14/h2-6,8,10-11,15H,7,9,12H2,1H3 |
| InChIKey | XCQFRGCFLVIEQI-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |