C14H11N5 — CID 13336955
5-(ethylamino)-6-phenylpyrazine-2,3-dicarbonitrile (PubChem CID 13336955) has the molecular formula C14H11N5 and a molecular weight of 249.28 g/mol. Its IUPAC name is 5-(ethylamino)-6-phenylpyrazine-2,3-dicarbonitrile.
| Compound Name | 5-(ethylamino)-6-phenylpyrazine-2,3-dicarbonitrile |
|---|---|
| PubChem CID | 13336955 |
| Molecular Formula | C14H11N5 |
| Molecular Weight | 249.28 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 5-(ethylamino)-6-phenylpyrazine-2,3-dicarbonitrile |
| SMILES | CCNc1nc(C#N)c(C#N)nc1-c1ccccc1 |
| InChI | InChI=1S/C14H11N5/c1-2-17-14-13(10-6-4-3-5-7-10)18-11(8-15)12(9-16)19-14/h3-7H,2H2,1H3,(H,17,19) |
| InChIKey | WQRUYWHPVVDBKN-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 85.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.28 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |