About 5-(ethylamino)-6-(3-fluorophenyl)pyrazine-2,3-dicarbonitrile
5-(ethylamino)-6-(3-fluorophenyl)pyrazine-2,3-dicarbonitrile (PubChem CID 13336999) has the molecular formula C14H10FN5
and a molecular weight of 267.27 g/mol. Its IUPAC name is 5-(ethylamino)-6-(3-fluorophenyl)pyrazine-2,3-dicarbonitrile.
Molecular Properties
| Compound Name | 5-(ethylamino)-6-(3-fluorophenyl)pyrazine-2,3-dicarbonitrile |
| PubChem CID | 13336999 |
| Molecular Formula | C14H10FN5 |
| Molecular Weight | 267.27 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 5-(ethylamino)-6-(3-fluorophenyl)pyrazine-2,3-dicarbonitrile |
| SMILES | CCNc1nc(C#N)c(C#N)nc1-c1cccc(F)c1 |
| InChI | InChI=1S/C14H10FN5/c1-2-18-14-13(9-4-3-5-10(15)6-9)19-11(7-16)12(8-17)20-14/h3-6H,2H2,1H3,(H,18,20) |
| InChIKey | PGIBWFNQVVPUTN-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 85.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.27 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(ethylamino)-6-(3-fluorophenyl)pyrazine-2,3-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(ethylamino)-6-(3-fluorophenyl)pyrazine-2,3-dicarbonitrile?
The IUPAC name of 5-(ethylamino)-6-(3-fluorophenyl)pyrazine-2,3-dicarbonitrile (CID 13336999) is 5-(ethylamino)-6-(3-fluorophenyl)pyrazine-2,3-dicarbonitrile.
What is the SMILES notation for 5-(ethylamino)-6-(3-fluorophenyl)pyrazine-2,3-dicarbonitrile?
The canonical SMILES for 5-(ethylamino)-6-(3-fluorophenyl)pyrazine-2,3-dicarbonitrile is CCNc1nc(C#N)c(C#N)nc1-c1cccc(F)c1.
What is the InChIKey of 5-(ethylamino)-6-(3-fluorophenyl)pyrazine-2,3-dicarbonitrile?
The InChIKey is PGIBWFNQVVPUTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10FN5/c1-2-18-14-13(9-4-3-5-10(15)6-9)19-11(7-16)12(8-17)20-14/h3-6H,2H2,1H3,(H,18,20).
What are the key properties of 5-(ethylamino)-6-(3-fluorophenyl)pyrazine-2,3-dicarbonitrile?
5-(ethylamino)-6-(3-fluorophenyl)pyrazine-2,3-dicarbonitrile has a molecular weight of 267.27 g/mol, XLogP of 2.46, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(ethylamino)-6-(3-fluorophenyl)pyrazine-2,3-dicarbonitrile is sourced from PubChem (CID 13336999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).