C17H21N3S — CID 133369991
N-(1-cyclopropylpiperidin-4-yl)-5-phenyl-1,3-thiazol-2-amine (PubChem CID 133369991) has the molecular formula C17H21N3S and a molecular weight of 299.44 g/mol. Its IUPAC name is N-(1-cyclopropylpiperidin-4-yl)-5-phenyl-1,3-thiazol-2-amine.
| Compound Name | N-(1-cyclopropylpiperidin-4-yl)-5-phenyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 133369991 |
| Molecular Formula | C17H21N3S |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | N-(1-cyclopropylpiperidin-4-yl)-5-phenyl-1,3-thiazol-2-amine |
| SMILES | c1ccc(-c2cnc(NC3CCN(C4CC4)CC3)s2)cc1 |
| InChI | InChI=1S/C17H21N3S/c1-2-4-13(5-3-1)16-12-18-17(21-16)19-14-8-10-20(11-9-14)15-6-7-15/h1-5,12,14-15H,6-11H2,(H,18,19) |
| InChIKey | LDJXOZSVGHURIV-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |