About 5,6-bis(ethylsulfanyl)pyrazine-2,3-dicarbonitrile
5,6-bis(ethylsulfanyl)pyrazine-2,3-dicarbonitrile (PubChem CID 13337053) has the molecular formula C10H10N4S2
and a molecular weight of 250.35 g/mol. Its IUPAC name is 5,6-bis(ethylsulfanyl)pyrazine-2,3-dicarbonitrile.
Molecular Properties
| Compound Name | 5,6-bis(ethylsulfanyl)pyrazine-2,3-dicarbonitrile |
| PubChem CID | 13337053 |
| Molecular Formula | C10H10N4S2 |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.03 |
| IUPAC Name | 5,6-bis(ethylsulfanyl)pyrazine-2,3-dicarbonitrile |
| SMILES | CCSc1nc(C#N)c(C#N)nc1SCC |
| InChI | InChI=1S/C10H10N4S2/c1-3-15-9-10(16-4-2)14-8(6-12)7(5-11)13-9/h3-4H2,1-2H3 |
| InChIKey | QIGLXHNUDJRYSQ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 73.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5,6-bis(ethylsulfanyl)pyrazine-2,3-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-bis(ethylsulfanyl)pyrazine-2,3-dicarbonitrile?
The IUPAC name of 5,6-bis(ethylsulfanyl)pyrazine-2,3-dicarbonitrile (CID 13337053) is 5,6-bis(ethylsulfanyl)pyrazine-2,3-dicarbonitrile.
What is the SMILES notation for 5,6-bis(ethylsulfanyl)pyrazine-2,3-dicarbonitrile?
The canonical SMILES for 5,6-bis(ethylsulfanyl)pyrazine-2,3-dicarbonitrile is CCSc1nc(C#N)c(C#N)nc1SCC.
What is the InChIKey of 5,6-bis(ethylsulfanyl)pyrazine-2,3-dicarbonitrile?
The InChIKey is QIGLXHNUDJRYSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N4S2/c1-3-15-9-10(16-4-2)14-8(6-12)7(5-11)13-9/h3-4H2,1-2H3.
What are the key properties of 5,6-bis(ethylsulfanyl)pyrazine-2,3-dicarbonitrile?
5,6-bis(ethylsulfanyl)pyrazine-2,3-dicarbonitrile has a molecular weight of 250.35 g/mol, XLogP of 2.44, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-bis(ethylsulfanyl)pyrazine-2,3-dicarbonitrile is sourced from PubChem (CID 13337053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).