C17H16F4N2O2 — CID 133370716
N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylpropyl]-2,3,5,6-tetrafluoropyridin-4-amine (PubChem CID 133370716) has the molecular formula C17H16F4N2O2 and a molecular weight of 356.32 g/mol. Its IUPAC name is N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylpropyl]-2,3,5,6-tetrafluoropyridin-4-amine.
| Compound Name | N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylpropyl]-2,3,5,6-tetrafluoropyridin-4-amine |
|---|---|
| PubChem CID | 133370716 |
| Molecular Formula | C17H16F4N2O2 |
| Molecular Weight | 356.32 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylpropyl]-2,3,5,6-tetrafluoropyridin-4-amine |
| SMILES | CC(C)C(Nc1c(F)c(F)nc(F)c1F)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C17H16F4N2O2/c1-8(2)14(9-3-4-10-11(7-9)25-6-5-24-10)22-15-12(18)16(20)23-17(21)13(15)19/h3-4,7-8,14H,5-6H2,1-2H3,(H,22,23) |
| InChIKey | GLYSPWWJPIHDNO-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.32 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|