C22H22FN3OS — CID 133370734
N-benzyl-1-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]piperidine-4-carboxamide (PubChem CID 133370734) has the molecular formula C22H22FN3OS and a molecular weight of 395.50 g/mol. Its IUPAC name is N-benzyl-1-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]piperidine-4-carboxamide.
| Compound Name | N-benzyl-1-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 133370734 |
| Molecular Formula | C22H22FN3OS |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | N-benzyl-1-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]piperidine-4-carboxamide |
| SMILES | O=C(NCc1ccccc1)C1CCN(c2nc(-c3ccc(F)cc3)cs2)CC1 |
| InChI | InChI=1S/C22H22FN3OS/c23-19-8-6-17(7-9-19)20-15-28-22(25-20)26-12-10-18(11-13-26)21(27)24-14-16-4-2-1-3-5-16/h1-9,15,18H,10-14H2,(H,24,27) |
| InChIKey | ILKRNCVEUKDJLX-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |