C14H9F4N3O2 — CID 133370776
2-methyl-6-[(2,3,5,6-tetrafluoro-4-pyridinyl)amino]-4H-1,4-benzoxazin-3-one (PubChem CID 133370776) has the molecular formula C14H9F4N3O2 and a molecular weight of 327.24 g/mol. Its IUPAC name is 2-methyl-6-[(2,3,5,6-tetrafluoro-4-pyridinyl)amino]-4H-1,4-benzoxazin-3-one.
| Compound Name | 2-methyl-6-[(2,3,5,6-tetrafluoro-4-pyridinyl)amino]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 133370776 |
| Molecular Formula | C14H9F4N3O2 |
| Molecular Weight | 327.24 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | 2-methyl-6-[(2,3,5,6-tetrafluoro-4-pyridinyl)amino]-4H-1,4-benzoxazin-3-one |
| SMILES | CC1Oc2ccc(Nc3c(F)c(F)nc(F)c3F)cc2NC1=O |
| InChI | InChI=1S/C14H9F4N3O2/c1-5-14(22)20-7-4-6(2-3-8(7)23-5)19-11-9(15)12(17)21-13(18)10(11)16/h2-5H,1H3,(H,19,21)(H,20,22) |
| InChIKey | ZATJWWYNOYPUOH-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.24 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|