C15H12F4N4OS — CID 133370869
2,3,5,6-tetrafluoro-4-[[5-(furan-2-yl)-4-(2-methylpropyl)-1,2,4-triazol-3-yl]sulfanyl]pyridine (PubChem CID 133370869) has the molecular formula C15H12F4N4OS and a molecular weight of 372.35 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-[[5-(furan-2-yl)-4-(2-methylpropyl)-1,2,4-triazol-3-yl]sulfanyl]pyridine.
| Compound Name | 2,3,5,6-tetrafluoro-4-[[5-(furan-2-yl)-4-(2-methylpropyl)-1,2,4-triazol-3-yl]sulfanyl]pyridine |
|---|---|
| PubChem CID | 133370869 |
| Molecular Formula | C15H12F4N4OS |
| Molecular Weight | 372.35 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-[[5-(furan-2-yl)-4-(2-methylpropyl)-1,2,4-triazol-3-yl]sulfanyl]pyridine |
| SMILES | CC(C)Cn1c(Sc2c(F)c(F)nc(F)c2F)nnc1-c1ccco1 |
| InChI | InChI=1S/C15H12F4N4OS/c1-7(2)6-23-14(8-4-3-5-24-8)21-22-15(23)25-11-9(16)12(18)20-13(19)10(11)17/h3-5,7H,6H2,1-2H3 |
| InChIKey | NUHRMBDBCWETTE-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.35 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|