C11H9F4N3O2S2 — CID 133370930
N-methyl-5-[[(2,3,5,6-tetrafluoro-4-pyridinyl)amino]methyl]thiophene-2-sulfonamide (PubChem CID 133370930) has the molecular formula C11H9F4N3O2S2 and a molecular weight of 355.34 g/mol. Its IUPAC name is N-methyl-5-[[(2,3,5,6-tetrafluoro-4-pyridinyl)amino]methyl]thiophene-2-sulfonamide.
| Compound Name | N-methyl-5-[[(2,3,5,6-tetrafluoro-4-pyridinyl)amino]methyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 133370930 |
| Molecular Formula | C11H9F4N3O2S2 |
| Molecular Weight | 355.34 g/mol |
| Exact Mass | 355.01 |
| IUPAC Name | N-methyl-5-[[(2,3,5,6-tetrafluoro-4-pyridinyl)amino]methyl]thiophene-2-sulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(CNc2c(F)c(F)nc(F)c2F)s1 |
| InChI | InChI=1S/C11H9F4N3O2S2/c1-16-22(19,20)6-3-2-5(21-6)4-17-9-7(12)10(14)18-11(15)8(9)13/h2-3,16H,4H2,1H3,(H,17,18) |
| InChIKey | KUBYOHRQQOCSJX-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.34 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|