C16H11F4N5OS — CID 133371071
N-[3-[3-methyl-5-[(2,3,5,6-tetrafluoro-4-pyridinyl)sulfanyl]-1,2,4-triazol-4-yl]phenyl]acetamide (PubChem CID 133371071) has the molecular formula C16H11F4N5OS and a molecular weight of 397.36 g/mol. Its IUPAC name is N-[3-[3-methyl-5-[(2,3,5,6-tetrafluoro-4-pyridinyl)sulfanyl]-1,2,4-triazol-4-yl]phenyl]acetamide.
| Compound Name | N-[3-[3-methyl-5-[(2,3,5,6-tetrafluoro-4-pyridinyl)sulfanyl]-1,2,4-triazol-4-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 133371071 |
| Molecular Formula | C16H11F4N5OS |
| Molecular Weight | 397.36 g/mol |
| Exact Mass | 397.06 |
| IUPAC Name | N-[3-[3-methyl-5-[(2,3,5,6-tetrafluoro-4-pyridinyl)sulfanyl]-1,2,4-triazol-4-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(-n2c(C)nnc2Sc2c(F)c(F)nc(F)c2F)c1 |
| InChI | InChI=1S/C16H11F4N5OS/c1-7-23-24-16(27-13-11(17)14(19)22-15(20)12(13)18)25(7)10-5-3-4-9(6-10)21-8(2)26/h3-6H,1-2H3,(H,21,26) |
| InChIKey | QHRDAPWUVKGADI-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.36 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|