C15H12F5N3 — CID 133371577
2,3,5,6-tetrafluoro-N-(3-fluoro-4-pyrrolidin-1-ylphenyl)pyridin-4-amine (PubChem CID 133371577) has the molecular formula C15H12F5N3 and a molecular weight of 329.27 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-N-(3-fluoro-4-pyrrolidin-1-ylphenyl)pyridin-4-amine.
| Compound Name | 2,3,5,6-tetrafluoro-N-(3-fluoro-4-pyrrolidin-1-ylphenyl)pyridin-4-amine |
|---|---|
| PubChem CID | 133371577 |
| Molecular Formula | C15H12F5N3 |
| Molecular Weight | 329.27 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 2,3,5,6-tetrafluoro-N-(3-fluoro-4-pyrrolidin-1-ylphenyl)pyridin-4-amine |
| SMILES | Fc1cc(Nc2c(F)c(F)nc(F)c2F)ccc1N1CCCC1 |
| InChI | InChI=1S/C15H12F5N3/c16-9-7-8(3-4-10(9)23-5-1-2-6-23)21-13-11(17)14(19)22-15(20)12(13)18/h3-4,7H,1-2,5-6H2,(H,21,22) |
| InChIKey | NKSUHBQDRCPSGS-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.27 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|