C15H11BrF4N2 — CID 133371579
4-[2-(3-bromophenyl)pyrrolidin-1-yl]-2,3,5,6-tetrafluoropyridine (PubChem CID 133371579) has the molecular formula C15H11BrF4N2 and a molecular weight of 375.16 g/mol. Its IUPAC name is 4-[2-(3-bromophenyl)pyrrolidin-1-yl]-2,3,5,6-tetrafluoropyridine.
| Compound Name | 4-[2-(3-bromophenyl)pyrrolidin-1-yl]-2,3,5,6-tetrafluoropyridine |
|---|---|
| PubChem CID | 133371579 |
| Molecular Formula | C15H11BrF4N2 |
| Molecular Weight | 375.16 g/mol |
| Exact Mass | 374.00 |
| IUPAC Name | 4-[2-(3-bromophenyl)pyrrolidin-1-yl]-2,3,5,6-tetrafluoropyridine |
| SMILES | Fc1nc(F)c(F)c(N2CCCC2c2cccc(Br)c2)c1F |
| InChI | InChI=1S/C15H11BrF4N2/c16-9-4-1-3-8(7-9)10-5-2-6-22(10)13-11(17)14(19)21-15(20)12(13)18/h1,3-4,7,10H,2,5-6H2 |
| InChIKey | IVDPEMYQGGUQRZ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.16 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|