C15H15F4N5 — CID 133372358
N-methyl-N-[1-(2,3,5,6-tetrafluoro-4-pyridinyl)piperidin-4-yl]pyridazin-3-amine (PubChem CID 133372358) has the molecular formula C15H15F4N5 and a molecular weight of 341.31 g/mol. Its IUPAC name is N-methyl-N-[1-(2,3,5,6-tetrafluoro-4-pyridinyl)piperidin-4-yl]pyridazin-3-amine.
| Compound Name | N-methyl-N-[1-(2,3,5,6-tetrafluoro-4-pyridinyl)piperidin-4-yl]pyridazin-3-amine |
|---|---|
| PubChem CID | 133372358 |
| Molecular Formula | C15H15F4N5 |
| Molecular Weight | 341.31 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | N-methyl-N-[1-(2,3,5,6-tetrafluoro-4-pyridinyl)piperidin-4-yl]pyridazin-3-amine |
| SMILES | CN(c1cccnn1)C1CCN(c2c(F)c(F)nc(F)c2F)CC1 |
| InChI | InChI=1S/C15H15F4N5/c1-23(10-3-2-6-20-22-10)9-4-7-24(8-5-9)13-11(16)14(18)21-15(19)12(13)17/h2-3,6,9H,4-5,7-8H2,1H3 |
| InChIKey | FKTSGGVBMOLRMO-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.31 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|