C17H20FN3S — CID 133372461
4-(4-fluorophenyl)-N-(1-prop-2-enylpiperidin-4-yl)-1,3-thiazol-2-amine (PubChem CID 133372461) has the molecular formula C17H20FN3S and a molecular weight of 317.43 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N-(1-prop-2-enylpiperidin-4-yl)-1,3-thiazol-2-amine.
| Compound Name | 4-(4-fluorophenyl)-N-(1-prop-2-enylpiperidin-4-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 133372461 |
| Molecular Formula | C17H20FN3S |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 4-(4-fluorophenyl)-N-(1-prop-2-enylpiperidin-4-yl)-1,3-thiazol-2-amine |
| SMILES | C=CCN1CCC(Nc2nc(-c3ccc(F)cc3)cs2)CC1 |
| InChI | InChI=1S/C17H20FN3S/c1-2-9-21-10-7-15(8-11-21)19-17-20-16(12-22-17)13-3-5-14(18)6-4-13/h2-6,12,15H,1,7-11H2,(H,19,20) |
| InChIKey | OTQBPOBTTYCGMZ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|