C14H12F4N2O2 — CID 133372605
1-(3-methoxyphenyl)-2-[(2,3,5,6-tetrafluoro-4-pyridinyl)amino]ethanol (PubChem CID 133372605) has the molecular formula C14H12F4N2O2 and a molecular weight of 316.25 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-2-[(2,3,5,6-tetrafluoro-4-pyridinyl)amino]ethanol.
| Compound Name | 1-(3-methoxyphenyl)-2-[(2,3,5,6-tetrafluoro-4-pyridinyl)amino]ethanol |
|---|---|
| PubChem CID | 133372605 |
| Molecular Formula | C14H12F4N2O2 |
| Molecular Weight | 316.25 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | 1-(3-methoxyphenyl)-2-[(2,3,5,6-tetrafluoro-4-pyridinyl)amino]ethanol |
| SMILES | COc1cccc(C(O)CNc2c(F)c(F)nc(F)c2F)c1 |
| InChI | InChI=1S/C14H12F4N2O2/c1-22-8-4-2-3-7(5-8)9(21)6-19-12-10(15)13(17)20-14(18)11(12)16/h2-5,9,21H,6H2,1H3,(H,19,20) |
| InChIKey | XKLOJYVIKBZFOB-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.25 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|