C21H17F4N3O3 — CID 133372618
4-methoxy-N-[3-[2-[(2,3,5,6-tetrafluoro-4-pyridinyl)amino]ethoxy]phenyl]benzamide (PubChem CID 133372618) has the molecular formula C21H17F4N3O3 and a molecular weight of 435.38 g/mol. Its IUPAC name is 4-methoxy-N-[3-[2-[(2,3,5,6-tetrafluoro-4-pyridinyl)amino]ethoxy]phenyl]benzamide.
| Compound Name | 4-methoxy-N-[3-[2-[(2,3,5,6-tetrafluoro-4-pyridinyl)amino]ethoxy]phenyl]benzamide |
|---|---|
| PubChem CID | 133372618 |
| Molecular Formula | C21H17F4N3O3 |
| Molecular Weight | 435.38 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | 4-methoxy-N-[3-[2-[(2,3,5,6-tetrafluoro-4-pyridinyl)amino]ethoxy]phenyl]benzamide |
| SMILES | COc1ccc(C(=O)Nc2cccc(OCCNc3c(F)c(F)nc(F)c3F)c2)cc1 |
| InChI | InChI=1S/C21H17F4N3O3/c1-30-14-7-5-12(6-8-14)21(29)27-13-3-2-4-15(11-13)31-10-9-26-18-16(22)19(24)28-20(25)17(18)23/h2-8,11H,9-10H2,1H3,(H,26,28)(H,27,29) |
| InChIKey | JQKOPDJRJYAZRL-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.38 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|