C16H9F4N3O — CID 133372663
2,3,5,6-tetrafluoro-N-(3-pyridin-4-yloxyphenyl)pyridin-4-amine (PubChem CID 133372663) has the molecular formula C16H9F4N3O and a molecular weight of 335.26 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-N-(3-pyridin-4-yloxyphenyl)pyridin-4-amine.
| Compound Name | 2,3,5,6-tetrafluoro-N-(3-pyridin-4-yloxyphenyl)pyridin-4-amine |
|---|---|
| PubChem CID | 133372663 |
| Molecular Formula | C16H9F4N3O |
| Molecular Weight | 335.26 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | 2,3,5,6-tetrafluoro-N-(3-pyridin-4-yloxyphenyl)pyridin-4-amine |
| SMILES | Fc1nc(F)c(F)c(Nc2cccc(Oc3ccncc3)c2)c1F |
| InChI | InChI=1S/C16H9F4N3O/c17-12-14(13(18)16(20)23-15(12)19)22-9-2-1-3-11(8-9)24-10-4-6-21-7-5-10/h1-8H,(H,22,23) |
| InChIKey | LENGJRLIUXODJH-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.26 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|