C14H7F4N5O2S — CID 133372880
4-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)tetrazol-5-yl]sulfanyl-2,3,5,6-tetrafluoropyridine (PubChem CID 133372880) has the molecular formula C14H7F4N5O2S and a molecular weight of 385.30 g/mol. Its IUPAC name is 4-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)tetrazol-5-yl]sulfanyl-2,3,5,6-tetrafluoropyridine.
| Compound Name | 4-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)tetrazol-5-yl]sulfanyl-2,3,5,6-tetrafluoropyridine |
|---|---|
| PubChem CID | 133372880 |
| Molecular Formula | C14H7F4N5O2S |
| Molecular Weight | 385.30 g/mol |
| Exact Mass | 385.03 |
| IUPAC Name | 4-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)tetrazol-5-yl]sulfanyl-2,3,5,6-tetrafluoropyridine |
| SMILES | Fc1nc(F)c(F)c(Sc2nnnn2-c2ccc3c(c2)OCCO3)c1F |
| InChI | InChI=1S/C14H7F4N5O2S/c15-9-11(10(16)13(18)19-12(9)17)26-14-20-21-22-23(14)6-1-2-7-8(5-6)25-4-3-24-7/h1-2,5H,3-4H2 |
| InChIKey | NKLIEHPNCMLBRT-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 74.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.30 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|