C17H22N4O3S — CID 133373984
N-[2-[(6-tert-butylsulfonyl-3-pyridinyl)amino]ethyl]pyridine-3-carboxamide (PubChem CID 133373984) has the molecular formula C17H22N4O3S and a molecular weight of 362.46 g/mol. Its IUPAC name is N-[2-[(6-tert-butylsulfonyl-3-pyridinyl)amino]ethyl]pyridine-3-carboxamide.
| Compound Name | N-[2-[(6-tert-butylsulfonyl-3-pyridinyl)amino]ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 133373984 |
| Molecular Formula | C17H22N4O3S |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | N-[2-[(6-tert-butylsulfonyl-3-pyridinyl)amino]ethyl]pyridine-3-carboxamide |
| SMILES | CC(C)(C)S(=O)(=O)c1ccc(NCCNC(=O)c2cccnc2)cn1 |
| InChI | InChI=1S/C17H22N4O3S/c1-17(2,3)25(23,24)15-7-6-14(12-21-15)19-9-10-20-16(22)13-5-4-8-18-11-13/h4-8,11-12,19H,9-10H2,1-3H3,(H,20,22) |
| InChIKey | VLUZYTMDBYSAES-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|