About 1-[1-(6-ethoxypyrazin-2-yl)piperidin-4-yl]-2,2,2-trifluoroethanol
1-[1-(6-ethoxypyrazin-2-yl)piperidin-4-yl]-2,2,2-trifluoroethanol (PubChem CID 133375024) has the molecular formula C13H18F3N3O2
and a molecular weight of 305.30 g/mol. Its IUPAC name is 1-[1-(6-ethoxypyrazin-2-yl)piperidin-4-yl]-2,2,2-trifluoroethanol.
Molecular Properties
| Compound Name | 1-[1-(6-ethoxypyrazin-2-yl)piperidin-4-yl]-2,2,2-trifluoroethanol |
| PubChem CID | 133375024 |
| Molecular Formula | C13H18F3N3O2 |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 1-[1-(6-ethoxypyrazin-2-yl)piperidin-4-yl]-2,2,2-trifluoroethanol |
| SMILES | CCOc1cncc(N2CCC(C(O)C(F)(F)F)CC2)n1 |
| InChI | InChI=1S/C13H18F3N3O2/c1-2-21-11-8-17-7-10(18-11)19-5-3-9(4-6-19)12(20)13(14,15)16/h7-9,12,20H,2-6H2,1H3 |
| InChIKey | HXKFOWLSFVSMPG-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 58.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[1-(6-ethoxypyrazin-2-yl)piperidin-4-yl]-2,2,2-trifluoroethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(6-ethoxypyrazin-2-yl)piperidin-4-yl]-2,2,2-trifluoroethanol?
The IUPAC name of 1-[1-(6-ethoxypyrazin-2-yl)piperidin-4-yl]-2,2,2-trifluoroethanol (CID 133375024) is 1-[1-(6-ethoxypyrazin-2-yl)piperidin-4-yl]-2,2,2-trifluoroethanol.
What is the SMILES notation for 1-[1-(6-ethoxypyrazin-2-yl)piperidin-4-yl]-2,2,2-trifluoroethanol?
The canonical SMILES for 1-[1-(6-ethoxypyrazin-2-yl)piperidin-4-yl]-2,2,2-trifluoroethanol is CCOc1cncc(N2CCC(C(O)C(F)(F)F)CC2)n1.
What is the InChIKey of 1-[1-(6-ethoxypyrazin-2-yl)piperidin-4-yl]-2,2,2-trifluoroethanol?
The InChIKey is HXKFOWLSFVSMPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18F3N3O2/c1-2-21-11-8-17-7-10(18-11)19-5-3-9(4-6-19)12(20)13(14,15)16/h7-9,12,20H,2-6H2,1H3.
What are the key properties of 1-[1-(6-ethoxypyrazin-2-yl)piperidin-4-yl]-2,2,2-trifluoroethanol?
1-[1-(6-ethoxypyrazin-2-yl)piperidin-4-yl]-2,2,2-trifluoroethanol has a molecular weight of 305.30 g/mol, XLogP of 2.01, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(6-ethoxypyrazin-2-yl)piperidin-4-yl]-2,2,2-trifluoroethanol is sourced from PubChem (CID 133375024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).