C22H20N6O — CID 133375389
6-[[2-(3-methylpyrazol-1-yl)phenyl]methylamino]-N-phenylpyridazine-3-carboxamide (PubChem CID 133375389) has the molecular formula C22H20N6O and a molecular weight of 384.44 g/mol. Its IUPAC name is 6-[[2-(3-methylpyrazol-1-yl)phenyl]methylamino]-N-phenylpyridazine-3-carboxamide.
| Compound Name | 6-[[2-(3-methylpyrazol-1-yl)phenyl]methylamino]-N-phenylpyridazine-3-carboxamide |
|---|---|
| PubChem CID | 133375389 |
| Molecular Formula | C22H20N6O |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 6-[[2-(3-methylpyrazol-1-yl)phenyl]methylamino]-N-phenylpyridazine-3-carboxamide |
| SMILES | Cc1ccn(-c2ccccc2CNc2ccc(C(=O)Nc3ccccc3)nn2)n1 |
| InChI | InChI=1S/C22H20N6O/c1-16-13-14-28(27-16)20-10-6-5-7-17(20)15-23-21-12-11-19(25-26-21)22(29)24-18-8-3-2-4-9-18/h2-14H,15H2,1H3,(H,23,26)(H,24,29) |
| InChIKey | ZNTOASKKEIJPKV-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |