C18H24F3N3O3 — CID 133376347
2-[4-[4-nitro-2-(trifluoromethyl)anilino]piperidin-1-yl]cyclohexan-1-ol (PubChem CID 133376347) has the molecular formula C18H24F3N3O3 and a molecular weight of 387.40 g/mol. Its IUPAC name is 2-[4-[4-nitro-2-(trifluoromethyl)anilino]piperidin-1-yl]cyclohexan-1-ol.
| Compound Name | 2-[4-[4-nitro-2-(trifluoromethyl)anilino]piperidin-1-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 133376347 |
| Molecular Formula | C18H24F3N3O3 |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 2-[4-[4-nitro-2-(trifluoromethyl)anilino]piperidin-1-yl]cyclohexan-1-ol |
| SMILES | O=[N+]([O-])c1ccc(NC2CCN(C3CCCCC3O)CC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H24F3N3O3/c19-18(20,21)14-11-13(24(26)27)5-6-15(14)22-12-7-9-23(10-8-12)16-3-1-2-4-17(16)25/h5-6,11-12,16-17,22,25H,1-4,7-10H2 |
| InChIKey | PUWDHVUQYXGEPG-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 78.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|