About 2-[4-[2,6-dinitro-4-(trifluoromethyl)anilino]piperidin-1-yl]cyclohexan-1-ol
2-[4-[2,6-dinitro-4-(trifluoromethyl)anilino]piperidin-1-yl]cyclohexan-1-ol (PubChem CID 133376399) has the molecular formula C18H23F3N4O5
and a molecular weight of 432.40 g/mol. Its IUPAC name is 2-[4-[2,6-dinitro-4-(trifluoromethyl)anilino]piperidin-1-yl]cyclohexan-1-ol.
Molecular Properties
| Compound Name | 2-[4-[2,6-dinitro-4-(trifluoromethyl)anilino]piperidin-1-yl]cyclohexan-1-ol |
| PubChem CID | 133376399 |
| Molecular Formula | C18H23F3N4O5 |
| Molecular Weight | 432.40 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | 2-[4-[2,6-dinitro-4-(trifluoromethyl)anilino]piperidin-1-yl]cyclohexan-1-ol |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)cc([N+](=O)[O-])c1NC1CCN(C2CCCCC2O)CC1 |
| InChI | InChI=1S/C18H23F3N4O5/c19-18(20,21)11-9-14(24(27)28)17(15(10-11)25(29)30)22-12-5-7-23(8-6-12)13-3-1-2-4-16(13)26/h9-10,12-13,16,22,26H,1-8H2 |
| InChIKey | KFIAGZTZVIFCEB-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 121.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.40 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[2,6-dinitro-4-(trifluoromethyl)anilino]piperidin-1-yl]cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[2,6-dinitro-4-(trifluoromethyl)anilino]piperidin-1-yl]cyclohexan-1-ol?
The IUPAC name of 2-[4-[2,6-dinitro-4-(trifluoromethyl)anilino]piperidin-1-yl]cyclohexan-1-ol (CID 133376399) is 2-[4-[2,6-dinitro-4-(trifluoromethyl)anilino]piperidin-1-yl]cyclohexan-1-ol.
What is the SMILES notation for 2-[4-[2,6-dinitro-4-(trifluoromethyl)anilino]piperidin-1-yl]cyclohexan-1-ol?
The canonical SMILES for 2-[4-[2,6-dinitro-4-(trifluoromethyl)anilino]piperidin-1-yl]cyclohexan-1-ol is O=[N+]([O-])c1cc(C(F)(F)F)cc([N+](=O)[O-])c1NC1CCN(C2CCCCC2O)CC1.
What is the InChIKey of 2-[4-[2,6-dinitro-4-(trifluoromethyl)anilino]piperidin-1-yl]cyclohexan-1-ol?
The InChIKey is KFIAGZTZVIFCEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23F3N4O5/c19-18(20,21)11-9-14(24(27)28)17(15(10-11)25(29)30)22-12-5-7-23(8-6-12)13-3-1-2-4-16(13)26/h9-10,12-13,16,22,26H,1-8H2.
What are the key properties of 2-[4-[2,6-dinitro-4-(trifluoromethyl)anilino]piperidin-1-yl]cyclohexan-1-ol?
2-[4-[2,6-dinitro-4-(trifluoromethyl)anilino]piperidin-1-yl]cyclohexan-1-ol has a molecular weight of 432.40 g/mol, XLogP of 3.70, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[2,6-dinitro-4-(trifluoromethyl)anilino]piperidin-1-yl]cyclohexan-1-ol is sourced from PubChem (CID 133376399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).