About 4-(4-fluoro-3-methylphenoxy)-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonitrile
4-(4-fluoro-3-methylphenoxy)-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonitrile (PubChem CID 133376784) has the molecular formula C14H12FN3O3
and a molecular weight of 289.27 g/mol. Its IUPAC name is 4-(4-fluoro-3-methylphenoxy)-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonitrile.
Molecular Properties
| Compound Name | 4-(4-fluoro-3-methylphenoxy)-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonitrile |
| PubChem CID | 133376784 |
| Molecular Formula | C14H12FN3O3 |
| Molecular Weight | 289.27 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 4-(4-fluoro-3-methylphenoxy)-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonitrile |
| SMILES | Cc1cc(Oc2c(C#N)c(=O)n(C)c(=O)n2C)ccc1F |
| InChI | InChI=1S/C14H12FN3O3/c1-8-6-9(4-5-11(8)15)21-13-10(7-16)12(19)17(2)14(20)18(13)3/h4-6H,1-3H3 |
| InChIKey | ZQUWHUDUJATPBJ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 77.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.27 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(4-fluoro-3-methylphenoxy)-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-fluoro-3-methylphenoxy)-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonitrile?
The IUPAC name of 4-(4-fluoro-3-methylphenoxy)-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonitrile (CID 133376784) is 4-(4-fluoro-3-methylphenoxy)-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonitrile.
What is the SMILES notation for 4-(4-fluoro-3-methylphenoxy)-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonitrile?
The canonical SMILES for 4-(4-fluoro-3-methylphenoxy)-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonitrile is Cc1cc(Oc2c(C#N)c(=O)n(C)c(=O)n2C)ccc1F.
What is the InChIKey of 4-(4-fluoro-3-methylphenoxy)-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonitrile?
The InChIKey is ZQUWHUDUJATPBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12FN3O3/c1-8-6-9(4-5-11(8)15)21-13-10(7-16)12(19)17(2)14(20)18(13)3/h4-6H,1-3H3.
What are the key properties of 4-(4-fluoro-3-methylphenoxy)-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonitrile?
4-(4-fluoro-3-methylphenoxy)-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonitrile has a molecular weight of 289.27 g/mol, XLogP of 1.20, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-fluoro-3-methylphenoxy)-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonitrile is sourced from PubChem (CID 133376784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).