C15H10FN3OS — CID 133376876
4-(6-ethylthieno[2,3-d]pyrimidin-4-yl)oxy-3-fluorobenzonitrile (PubChem CID 133376876) has the molecular formula C15H10FN3OS and a molecular weight of 299.33 g/mol. Its IUPAC name is 4-(6-ethylthieno[2,3-d]pyrimidin-4-yl)oxy-3-fluorobenzonitrile.
| Compound Name | 4-(6-ethylthieno[2,3-d]pyrimidin-4-yl)oxy-3-fluorobenzonitrile |
|---|---|
| PubChem CID | 133376876 |
| Molecular Formula | C15H10FN3OS |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | 4-(6-ethylthieno[2,3-d]pyrimidin-4-yl)oxy-3-fluorobenzonitrile |
| SMILES | CCc1cc2c(Oc3ccc(C#N)cc3F)ncnc2s1 |
| InChI | InChI=1S/C15H10FN3OS/c1-2-10-6-11-14(18-8-19-15(11)21-10)20-13-4-3-9(7-17)5-12(13)16/h3-6,8H,2H2,1H3 |
| InChIKey | LZJGZAVJLHFIKI-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 58.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |