C17H20F2N2O — CID 133377939
3,5-difluoro-4-(1-oxaspiro[5.5]undecan-4-ylamino)benzonitrile (PubChem CID 133377939) has the molecular formula C17H20F2N2O and a molecular weight of 306.36 g/mol. Its IUPAC name is 3,5-difluoro-4-(1-oxaspiro[5.5]undecan-4-ylamino)benzonitrile.
| Compound Name | 3,5-difluoro-4-(1-oxaspiro[5.5]undecan-4-ylamino)benzonitrile |
|---|---|
| PubChem CID | 133377939 |
| Molecular Formula | C17H20F2N2O |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 3,5-difluoro-4-(1-oxaspiro[5.5]undecan-4-ylamino)benzonitrile |
| SMILES | N#Cc1cc(F)c(NC2CCOC3(CCCCC3)C2)c(F)c1 |
| InChI | InChI=1S/C17H20F2N2O/c18-14-8-12(11-20)9-15(19)16(14)21-13-4-7-22-17(10-13)5-2-1-3-6-17/h8-9,13,21H,1-7,10H2 |
| InChIKey | LXLBOVSMBOSHBL-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |