C20H20FN5O3 — CID 133378519
[5-[2-(6-fluoro-1H-benzimidazol-2-yl)ethylamino]-2-nitrophenyl]-pyrrolidin-1-ylmethanone (PubChem CID 133378519) has the molecular formula C20H20FN5O3 and a molecular weight of 397.41 g/mol. Its IUPAC name is [5-[2-(6-fluoro-1H-benzimidazol-2-yl)ethylamino]-2-nitrophenyl]-pyrrolidin-1-ylmethanone.
| Compound Name | [5-[2-(6-fluoro-1H-benzimidazol-2-yl)ethylamino]-2-nitrophenyl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 133378519 |
| Molecular Formula | C20H20FN5O3 |
| Molecular Weight | 397.41 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | [5-[2-(6-fluoro-1H-benzimidazol-2-yl)ethylamino]-2-nitrophenyl]-pyrrolidin-1-ylmethanone |
| SMILES | O=C(c1cc(NCCc2nc3ccc(F)cc3[nH]2)ccc1[N+](=O)[O-])N1CCCC1 |
| InChI | InChI=1S/C20H20FN5O3/c21-13-3-5-16-17(11-13)24-19(23-16)7-8-22-14-4-6-18(26(28)29)15(12-14)20(27)25-9-1-2-10-25/h3-6,11-12,22H,1-2,7-10H2,(H,23,24) |
| InChIKey | GGRWWZLMQCEZAU-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 104.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.41 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|