About methyl (6R)-4-(5,6-dimethyl-2-pyridin-3-ylpyrimidin-4-yl)-6-methylmorpholine-2-carboxylate
methyl (6R)-4-(5,6-dimethyl-2-pyridin-3-ylpyrimidin-4-yl)-6-methylmorpholine-2-carboxylate (PubChem CID 133379732) has the molecular formula C18H22N4O3
and a molecular weight of 342.40 g/mol. Its IUPAC name is methyl (6R)-4-(5,6-dimethyl-2-pyridin-3-ylpyrimidin-4-yl)-6-methylmorpholine-2-carboxylate.
Molecular Properties
| Compound Name | methyl (6R)-4-(5,6-dimethyl-2-pyridin-3-ylpyrimidin-4-yl)-6-methylmorpholine-2-carboxylate |
| PubChem CID | 133379732 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | methyl (6R)-4-(5,6-dimethyl-2-pyridin-3-ylpyrimidin-4-yl)-6-methylmorpholine-2-carboxylate |
| SMILES | COC(=O)C1CN(c2nc(-c3cccnc3)nc(C)c2C)C[C@@H](C)O1 |
| InChI | InChI=1S/C18H22N4O3/c1-11-9-22(10-15(25-11)18(23)24-4)17-12(2)13(3)20-16(21-17)14-6-5-7-19-8-14/h5-8,11,15H,9-10H2,1-4H3/t11-,15?/m1/s1 |
| InChIKey | QGACUADRTKNUNU-ZRKZCGFPSA-N |
| XLogP | 1.92 |
| TPSA | 77.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl (6R)-4-(5,6-dimethyl-2-pyridin-3-ylpyrimidin-4-yl)-6-methylmorpholine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (6R)-4-(5,6-dimethyl-2-pyridin-3-ylpyrimidin-4-yl)-6-methylmorpholine-2-carboxylate?
The IUPAC name of methyl (6R)-4-(5,6-dimethyl-2-pyridin-3-ylpyrimidin-4-yl)-6-methylmorpholine-2-carboxylate (CID 133379732) is methyl (6R)-4-(5,6-dimethyl-2-pyridin-3-ylpyrimidin-4-yl)-6-methylmorpholine-2-carboxylate.
What is the SMILES notation for methyl (6R)-4-(5,6-dimethyl-2-pyridin-3-ylpyrimidin-4-yl)-6-methylmorpholine-2-carboxylate?
The canonical SMILES for methyl (6R)-4-(5,6-dimethyl-2-pyridin-3-ylpyrimidin-4-yl)-6-methylmorpholine-2-carboxylate is COC(=O)C1CN(c2nc(-c3cccnc3)nc(C)c2C)C[C@@H](C)O1.
What is the InChIKey of methyl (6R)-4-(5,6-dimethyl-2-pyridin-3-ylpyrimidin-4-yl)-6-methylmorpholine-2-carboxylate?
The InChIKey is QGACUADRTKNUNU-ZRKZCGFPSA-N. The full InChI is InChI=1S/C18H22N4O3/c1-11-9-22(10-15(25-11)18(23)24-4)17-12(2)13(3)20-16(21-17)14-6-5-7-19-8-14/h5-8,11,15H,9-10H2,1-4H3/t11-,15?/m1/s1.
What are the key properties of methyl (6R)-4-(5,6-dimethyl-2-pyridin-3-ylpyrimidin-4-yl)-6-methylmorpholine-2-carboxylate?
methyl (6R)-4-(5,6-dimethyl-2-pyridin-3-ylpyrimidin-4-yl)-6-methylmorpholine-2-carboxylate has a molecular weight of 342.40 g/mol, XLogP of 1.92, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (6R)-4-(5,6-dimethyl-2-pyridin-3-ylpyrimidin-4-yl)-6-methylmorpholine-2-carboxylate is sourced from PubChem (CID 133379732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).