C18H21N5O — CID 133380147
4-methoxy-N-[(1-phenyl-3-propan-2-ylpyrazol-4-yl)methyl]pyrimidin-2-amine (PubChem CID 133380147) has the molecular formula C18H21N5O and a molecular weight of 323.40 g/mol. Its IUPAC name is 4-methoxy-N-[(1-phenyl-3-propan-2-ylpyrazol-4-yl)methyl]pyrimidin-2-amine.
| Compound Name | 4-methoxy-N-[(1-phenyl-3-propan-2-ylpyrazol-4-yl)methyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 133380147 |
| Molecular Formula | C18H21N5O |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 4-methoxy-N-[(1-phenyl-3-propan-2-ylpyrazol-4-yl)methyl]pyrimidin-2-amine |
| SMILES | COc1ccnc(NCc2cn(-c3ccccc3)nc2C(C)C)n1 |
| InChI | InChI=1S/C18H21N5O/c1-13(2)17-14(11-20-18-19-10-9-16(21-18)24-3)12-23(22-17)15-7-5-4-6-8-15/h4-10,12-13H,11H2,1-3H3,(H,19,20,21) |
| InChIKey | QDIDYCVPEXLGOW-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |