C15H16BrN5O — CID 133380991
4-bromo-2-[[ethyl-(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)amino]methyl]phenol (PubChem CID 133380991) has the molecular formula C15H16BrN5O and a molecular weight of 362.23 g/mol. Its IUPAC name is 4-bromo-2-[[ethyl-(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)amino]methyl]phenol.
| Compound Name | 4-bromo-2-[[ethyl-(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)amino]methyl]phenol |
|---|---|
| PubChem CID | 133380991 |
| Molecular Formula | C15H16BrN5O |
| Molecular Weight | 362.23 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | 4-bromo-2-[[ethyl-(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)amino]methyl]phenol |
| SMILES | CCN(Cc1cc(Br)ccc1O)c1cc(C)nc2ncnn12 |
| InChI | InChI=1S/C15H16BrN5O/c1-3-20(8-11-7-12(16)4-5-13(11)22)14-6-10(2)19-15-17-9-18-21(14)15/h4-7,9,22H,3,8H2,1-2H3 |
| InChIKey | DIUCVSANSSULFZ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 66.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.23 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|