C19H27N5O — CID 133381274
N,N-dimethyl-1-(3-morpholin-4-ylquinoxalin-2-yl)piperidin-4-amine (PubChem CID 133381274) has the molecular formula C19H27N5O and a molecular weight of 341.46 g/mol. Its IUPAC name is N,N-dimethyl-1-(3-morpholin-4-ylquinoxalin-2-yl)piperidin-4-amine.
| Compound Name | N,N-dimethyl-1-(3-morpholin-4-ylquinoxalin-2-yl)piperidin-4-amine |
|---|---|
| PubChem CID | 133381274 |
| Molecular Formula | C19H27N5O |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.22 |
| IUPAC Name | N,N-dimethyl-1-(3-morpholin-4-ylquinoxalin-2-yl)piperidin-4-amine |
| SMILES | CN(C)C1CCN(c2nc3ccccc3nc2N2CCOCC2)CC1 |
| InChI | InChI=1S/C19H27N5O/c1-22(2)15-7-9-23(10-8-15)18-19(24-11-13-25-14-12-24)21-17-6-4-3-5-16(17)20-18/h3-6,15H,7-14H2,1-2H3 |
| InChIKey | GYGNOFLSFCRJSU-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 44.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |