C18H21N3O3 — CID 133381840
6-(2,5-dimethylphenoxy)-N-(oxan-4-yl)pyridazine-3-carboxamide (PubChem CID 133381840) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is 6-(2,5-dimethylphenoxy)-N-(oxan-4-yl)pyridazine-3-carboxamide.
| Compound Name | 6-(2,5-dimethylphenoxy)-N-(oxan-4-yl)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 133381840 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 6-(2,5-dimethylphenoxy)-N-(oxan-4-yl)pyridazine-3-carboxamide |
| SMILES | Cc1ccc(C)c(Oc2ccc(C(=O)NC3CCOCC3)nn2)c1 |
| InChI | InChI=1S/C18H21N3O3/c1-12-3-4-13(2)16(11-12)24-17-6-5-15(20-21-17)18(22)19-14-7-9-23-10-8-14/h3-6,11,14H,7-10H2,1-2H3,(H,19,22) |
| InChIKey | QYXCLXTVDNMLMS-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |