C9H7F3N4S3 — CID 133382783
N-prop-2-enyl-5-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]sulfanyl]-1,3,4-thiadiazol-2-amine (PubChem CID 133382783) has the molecular formula C9H7F3N4S3 and a molecular weight of 324.38 g/mol. Its IUPAC name is N-prop-2-enyl-5-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]sulfanyl]-1,3,4-thiadiazol-2-amine.
| Compound Name | N-prop-2-enyl-5-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]sulfanyl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 133382783 |
| Molecular Formula | C9H7F3N4S3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 323.98 |
| IUPAC Name | N-prop-2-enyl-5-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]sulfanyl]-1,3,4-thiadiazol-2-amine |
| SMILES | C=CCNc1nnc(Sc2nc(C(F)(F)F)cs2)s1 |
| InChI | InChI=1S/C9H7F3N4S3/c1-2-3-13-6-15-16-8(18-6)19-7-14-5(4-17-7)9(10,11)12/h2,4H,1,3H2,(H,13,15) |
| InChIKey | NBEZKLVATNPEEK-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|