C13H18BrNO8S — CID 13338357
[(1R)-1-ethoxycarbonyloxyethyl] (2S,5R,6S)-6-bromo-3,3-dimethyl-4,4,7-trioxo-4lambda6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 13338357) has the molecular formula C13H18BrNO8S and a molecular weight of 428.26 g/mol. Its IUPAC name is [(1R)-1-ethoxycarbonyloxyethyl] (2S,5R,6S)-6-bromo-3,3-dimethyl-4,4,7-trioxo-4lambda6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | [(1R)-1-ethoxycarbonyloxyethyl] (2S,5R,6S)-6-bromo-3,3-dimethyl-4,4,7-trioxo-4lambda6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 13338357 |
| Molecular Formula | C13H18BrNO8S |
| Molecular Weight | 428.26 g/mol |
| Exact Mass | 426.99 |
| IUPAC Name | [(1R)-1-ethoxycarbonyloxyethyl] (2S,5R,6S)-6-bromo-3,3-dimethyl-4,4,7-trioxo-4lambda6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CCOC(=O)O[C@H](C)OC(=O)[C@@H]1N2C(=O)[C@H](Br)[C@H]2S(=O)(=O)C1(C)C |
| InChI | InChI=1S/C13H18BrNO8S/c1-5-21-12(18)23-6(2)22-11(17)8-13(3,4)24(19,20)10-7(14)9(16)15(8)10/h6-8,10H,5H2,1-4H3/t6-,7+,8+,10-/m1/s1 |
| InChIKey | VCXCTTZLCCKVLH-CHIQAWFVSA-N |
| XLogP | 0.56 |
| TPSA | 116.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.26 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|