About N-(furan-2-ylmethyl)-N-(oxolan-2-ylmethyl)-4-(trifluoromethyl)-1,3-thiazol-2-amine
N-(furan-2-ylmethyl)-N-(oxolan-2-ylmethyl)-4-(trifluoromethyl)-1,3-thiazol-2-amine (PubChem CID 133383675) has the molecular formula C14H15F3N2O2S
and a molecular weight of 332.35 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-N-(oxolan-2-ylmethyl)-4-(trifluoromethyl)-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | N-(furan-2-ylmethyl)-N-(oxolan-2-ylmethyl)-4-(trifluoromethyl)-1,3-thiazol-2-amine |
| PubChem CID | 133383675 |
| Molecular Formula | C14H15F3N2O2S |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | N-(furan-2-ylmethyl)-N-(oxolan-2-ylmethyl)-4-(trifluoromethyl)-1,3-thiazol-2-amine |
| SMILES | FC(F)(F)c1csc(N(Cc2ccco2)CC2CCCO2)n1 |
| InChI | InChI=1S/C14H15F3N2O2S/c15-14(16,17)12-9-22-13(18-12)19(7-10-3-1-5-20-10)8-11-4-2-6-21-11/h1,3,5,9,11H,2,4,6-8H2 |
| InChIKey | JVGHVQJPKFJFMP-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 38.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(furan-2-ylmethyl)-N-(oxolan-2-ylmethyl)-4-(trifluoromethyl)-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(furan-2-ylmethyl)-N-(oxolan-2-ylmethyl)-4-(trifluoromethyl)-1,3-thiazol-2-amine?
The IUPAC name of N-(furan-2-ylmethyl)-N-(oxolan-2-ylmethyl)-4-(trifluoromethyl)-1,3-thiazol-2-amine (CID 133383675) is N-(furan-2-ylmethyl)-N-(oxolan-2-ylmethyl)-4-(trifluoromethyl)-1,3-thiazol-2-amine.
What is the SMILES notation for N-(furan-2-ylmethyl)-N-(oxolan-2-ylmethyl)-4-(trifluoromethyl)-1,3-thiazol-2-amine?
The canonical SMILES for N-(furan-2-ylmethyl)-N-(oxolan-2-ylmethyl)-4-(trifluoromethyl)-1,3-thiazol-2-amine is FC(F)(F)c1csc(N(Cc2ccco2)CC2CCCO2)n1.
What is the InChIKey of N-(furan-2-ylmethyl)-N-(oxolan-2-ylmethyl)-4-(trifluoromethyl)-1,3-thiazol-2-amine?
The InChIKey is JVGHVQJPKFJFMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15F3N2O2S/c15-14(16,17)12-9-22-13(18-12)19(7-10-3-1-5-20-10)8-11-4-2-6-21-11/h1,3,5,9,11H,2,4,6-8H2.
What are the key properties of N-(furan-2-ylmethyl)-N-(oxolan-2-ylmethyl)-4-(trifluoromethyl)-1,3-thiazol-2-amine?
N-(furan-2-ylmethyl)-N-(oxolan-2-ylmethyl)-4-(trifluoromethyl)-1,3-thiazol-2-amine has a molecular weight of 332.35 g/mol, XLogP of 3.94, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(furan-2-ylmethyl)-N-(oxolan-2-ylmethyl)-4-(trifluoromethyl)-1,3-thiazol-2-amine is sourced from PubChem (CID 133383675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).