C12H15F3N2OS — CID 133383794
6-[4-(trifluoromethyl)-1,3-thiazol-2-yl]-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine (PubChem CID 133383794) has the molecular formula C12H15F3N2OS and a molecular weight of 292.33 g/mol. Its IUPAC name is 6-[4-(trifluoromethyl)-1,3-thiazol-2-yl]-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine.
| Compound Name | 6-[4-(trifluoromethyl)-1,3-thiazol-2-yl]-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine |
|---|---|
| PubChem CID | 133383794 |
| Molecular Formula | C12H15F3N2OS |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 6-[4-(trifluoromethyl)-1,3-thiazol-2-yl]-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine |
| SMILES | FC(F)(F)c1csc(N2CCC3OCCCC3C2)n1 |
| InChI | InChI=1S/C12H15F3N2OS/c13-12(14,15)10-7-19-11(16-10)17-4-3-9-8(6-17)2-1-5-18-9/h7-9H,1-6H2 |
| InChIKey | KIRDSTWVKOWHFM-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |