C11H15N5 — CID 13338380
3,5,8,11-tetramethyl-3,4,7,9,12-pentazatricyclo[7.3.0.02,6]dodeca-1(12),2(6),4,7-tetraene (PubChem CID 13338380) has the molecular formula C11H15N5 and a molecular weight of 217.28 g/mol. Its IUPAC name is 3,5,8,11-tetramethyl-3,4,7,9,12-pentazatricyclo[7.3.0.02,6]dodeca-1(12),2(6),4,7-tetraene.
| Compound Name | 3,5,8,11-tetramethyl-3,4,7,9,12-pentazatricyclo[7.3.0.02,6]dodeca-1(12),2(6),4,7-tetraene |
|---|---|
| PubChem CID | 13338380 |
| Molecular Formula | C11H15N5 |
| Molecular Weight | 217.28 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 3,5,8,11-tetramethyl-3,4,7,9,12-pentazatricyclo[7.3.0.02,6]dodeca-1(12),2(6),4,7-tetraene |
| SMILES | CC1=Nc2c(C)nn(C)c2C2=NC(C)CN12 |
| InChI | InChI=1S/C11H15N5/c1-6-5-16-8(3)13-9-7(2)14-15(4)10(9)11(16)12-6/h6H,5H2,1-4H3 |
| InChIKey | VJTDTMBPCVRULB-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 45.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.28 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |