C18H21F3N6 — CID 133383898
N-[[4-(dimethylamino)phenyl]methyl]-N-ethyl-5-methyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (PubChem CID 133383898) has the molecular formula C18H21F3N6 and a molecular weight of 378.40 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-N-ethyl-5-methyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-N-ethyl-5-methyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 133383898 |
| Molecular Formula | C18H21F3N6 |
| Molecular Weight | 378.40 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-N-ethyl-5-methyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| SMILES | CCN(Cc1ccc(N(C)C)cc1)c1cc(C)nc2nc(C(F)(F)F)nn12 |
| InChI | InChI=1S/C18H21F3N6/c1-5-26(11-13-6-8-14(9-7-13)25(3)4)15-10-12(2)22-17-23-16(18(19,20)21)24-27(15)17/h6-10H,5,11H2,1-4H3 |
| InChIKey | UOOJSSIVBWATQR-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 49.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.40 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|