C20H17FN4 — CID 133384302
6-[(4-fluorophenyl)methyl-(2-pyridin-2-ylethyl)amino]pyridine-3-carbonitrile (PubChem CID 133384302) has the molecular formula C20H17FN4 and a molecular weight of 332.38 g/mol. Its IUPAC name is 6-[(4-fluorophenyl)methyl-(2-pyridin-2-ylethyl)amino]pyridine-3-carbonitrile.
| Compound Name | 6-[(4-fluorophenyl)methyl-(2-pyridin-2-ylethyl)amino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 133384302 |
| Molecular Formula | C20H17FN4 |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 6-[(4-fluorophenyl)methyl-(2-pyridin-2-ylethyl)amino]pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(N(CCc2ccccn2)Cc2ccc(F)cc2)nc1 |
| InChI | InChI=1S/C20H17FN4/c21-18-7-4-16(5-8-18)15-25(12-10-19-3-1-2-11-23-19)20-9-6-17(13-22)14-24-20/h1-9,11,14H,10,12,15H2 |
| InChIKey | WDQZHURGYLLKLK-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 52.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |