C19H21N3O — CID 133384325
4-[(4-cyano-N-ethylanilino)methyl]-N,N-dimethylbenzamide (PubChem CID 133384325) has the molecular formula C19H21N3O and a molecular weight of 307.40 g/mol. Its IUPAC name is 4-[(4-cyano-N-ethylanilino)methyl]-N,N-dimethylbenzamide.
| Compound Name | 4-[(4-cyano-N-ethylanilino)methyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 133384325 |
| Molecular Formula | C19H21N3O |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | 4-[(4-cyano-N-ethylanilino)methyl]-N,N-dimethylbenzamide |
| SMILES | CCN(Cc1ccc(C(=O)N(C)C)cc1)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C19H21N3O/c1-4-22(18-11-7-15(13-20)8-12-18)14-16-5-9-17(10-6-16)19(23)21(2)3/h5-12H,4,14H2,1-3H3 |
| InChIKey | DYQSXNDBKRGLJT-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |