C19H21ClN4O — CID 133384424
[1-(1-chloroisoquinolin-3-yl)piperidin-3-yl]-(1-methylimidazol-2-yl)methanol (PubChem CID 133384424) has the molecular formula C19H21ClN4O and a molecular weight of 356.86 g/mol. Its IUPAC name is [1-(1-chloroisoquinolin-3-yl)piperidin-3-yl]-(1-methylimidazol-2-yl)methanol.
| Compound Name | [1-(1-chloroisoquinolin-3-yl)piperidin-3-yl]-(1-methylimidazol-2-yl)methanol |
|---|---|
| PubChem CID | 133384424 |
| Molecular Formula | C19H21ClN4O |
| Molecular Weight | 356.86 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | [1-(1-chloroisoquinolin-3-yl)piperidin-3-yl]-(1-methylimidazol-2-yl)methanol |
| SMILES | Cn1ccnc1C(O)C1CCCN(c2cc3ccccc3c(Cl)n2)C1 |
| InChI | InChI=1S/C19H21ClN4O/c1-23-10-8-21-19(23)17(25)14-6-4-9-24(12-14)16-11-13-5-2-3-7-15(13)18(20)22-16/h2-3,5,7-8,10-11,14,17,25H,4,6,9,12H2,1H3 |
| InChIKey | NMSQGASDWRGGHY-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.86 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|