C19H23N5O — CID 133384624
(1-methylimidazol-2-yl)-[1-(5-methylquinazolin-4-yl)piperidin-3-yl]methanol (PubChem CID 133384624) has the molecular formula C19H23N5O and a molecular weight of 337.43 g/mol. Its IUPAC name is (1-methylimidazol-2-yl)-[1-(5-methylquinazolin-4-yl)piperidin-3-yl]methanol.
| Compound Name | (1-methylimidazol-2-yl)-[1-(5-methylquinazolin-4-yl)piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 133384624 |
| Molecular Formula | C19H23N5O |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | (1-methylimidazol-2-yl)-[1-(5-methylquinazolin-4-yl)piperidin-3-yl]methanol |
| SMILES | Cc1cccc2ncnc(N3CCCC(C(O)c4nccn4C)C3)c12 |
| InChI | InChI=1S/C19H23N5O/c1-13-5-3-7-15-16(13)18(22-12-21-15)24-9-4-6-14(11-24)17(25)19-20-8-10-23(19)2/h3,5,7-8,10,12,14,17,25H,4,6,9,11H2,1-2H3 |
| InChIKey | BHVXLXSRJROVGY-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |