C17H21N7 — CID 133385992
N-[(1-cyclopentylpyrazol-3-yl)methyl]-6-(3-methylpyrazol-1-yl)pyridazin-3-amine (PubChem CID 133385992) has the molecular formula C17H21N7 and a molecular weight of 323.40 g/mol. Its IUPAC name is N-[(1-cyclopentylpyrazol-3-yl)methyl]-6-(3-methylpyrazol-1-yl)pyridazin-3-amine.
| Compound Name | N-[(1-cyclopentylpyrazol-3-yl)methyl]-6-(3-methylpyrazol-1-yl)pyridazin-3-amine |
|---|---|
| PubChem CID | 133385992 |
| Molecular Formula | C17H21N7 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | N-[(1-cyclopentylpyrazol-3-yl)methyl]-6-(3-methylpyrazol-1-yl)pyridazin-3-amine |
| SMILES | Cc1ccn(-c2ccc(NCc3ccn(C4CCCC4)n3)nn2)n1 |
| InChI | InChI=1S/C17H21N7/c1-13-8-10-24(21-13)17-7-6-16(19-20-17)18-12-14-9-11-23(22-14)15-4-2-3-5-15/h6-11,15H,2-5,12H2,1H3,(H,18,19) |
| InChIKey | DYJYBGWHZNEQGH-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 73.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |