C17H18BrF3N4 — CID 133386927
N-[1-[(4-bromophenyl)methyl]piperidin-4-yl]-4-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 133386927) has the molecular formula C17H18BrF3N4 and a molecular weight of 415.26 g/mol. Its IUPAC name is N-[1-[(4-bromophenyl)methyl]piperidin-4-yl]-4-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | N-[1-[(4-bromophenyl)methyl]piperidin-4-yl]-4-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 133386927 |
| Molecular Formula | C17H18BrF3N4 |
| Molecular Weight | 415.26 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | N-[1-[(4-bromophenyl)methyl]piperidin-4-yl]-4-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | FC(F)(F)c1ccnc(NC2CCN(Cc3ccc(Br)cc3)CC2)n1 |
| InChI | InChI=1S/C17H18BrF3N4/c18-13-3-1-12(2-4-13)11-25-9-6-14(7-10-25)23-16-22-8-5-15(24-16)17(19,20)21/h1-5,8,14H,6-7,9-11H2,(H,22,23,24) |
| InChIKey | WIMAFKYBDJAHKD-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.26 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |