About (5-chloroquinolin-8-yl) N-(2-chloroethyl)carbamate
(5-chloroquinolin-8-yl) N-(2-chloroethyl)carbamate (PubChem CID 13338832) has the molecular formula C12H10Cl2N2O2
and a molecular weight of 285.13 g/mol. Its IUPAC name is (5-chloroquinolin-8-yl) N-(2-chloroethyl)carbamate.
Molecular Properties
| Compound Name | (5-chloroquinolin-8-yl) N-(2-chloroethyl)carbamate |
| PubChem CID | 13338832 |
| Molecular Formula | C12H10Cl2N2O2 |
| Molecular Weight | 285.13 g/mol |
| Exact Mass | 284.01 |
| IUPAC Name | (5-chloroquinolin-8-yl) N-(2-chloroethyl)carbamate |
| SMILES | O=C(NCCCl)Oc1ccc(Cl)c2cccnc12 |
| InChI | InChI=1S/C12H10Cl2N2O2/c13-5-7-16-12(17)18-10-4-3-9(14)8-2-1-6-15-11(8)10/h1-4,6H,5,7H2,(H,16,17) |
| InChIKey | CZXHHJQIOHBLPF-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.13 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (5-chloroquinolin-8-yl) N-(2-chloroethyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-chloroquinolin-8-yl) N-(2-chloroethyl)carbamate?
The IUPAC name of (5-chloroquinolin-8-yl) N-(2-chloroethyl)carbamate (CID 13338832) is (5-chloroquinolin-8-yl) N-(2-chloroethyl)carbamate.
What is the SMILES notation for (5-chloroquinolin-8-yl) N-(2-chloroethyl)carbamate?
The canonical SMILES for (5-chloroquinolin-8-yl) N-(2-chloroethyl)carbamate is O=C(NCCCl)Oc1ccc(Cl)c2cccnc12.
What is the InChIKey of (5-chloroquinolin-8-yl) N-(2-chloroethyl)carbamate?
The InChIKey is CZXHHJQIOHBLPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10Cl2N2O2/c13-5-7-16-12(17)18-10-4-3-9(14)8-2-1-6-15-11(8)10/h1-4,6H,5,7H2,(H,16,17).
What are the key properties of (5-chloroquinolin-8-yl) N-(2-chloroethyl)carbamate?
(5-chloroquinolin-8-yl) N-(2-chloroethyl)carbamate has a molecular weight of 285.13 g/mol, XLogP of 3.22, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-chloroquinolin-8-yl) N-(2-chloroethyl)carbamate is sourced from PubChem (CID 13338832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).