C19H30N4O2 — CID 133389453
1-[2-(2,5-dimethylpyrrolidin-1-yl)ethyl]-4-(4-methyl-2-nitrophenyl)piperazine (PubChem CID 133389453) has the molecular formula C19H30N4O2 and a molecular weight of 346.48 g/mol. Its IUPAC name is 1-[2-(2,5-dimethylpyrrolidin-1-yl)ethyl]-4-(4-methyl-2-nitrophenyl)piperazine.
| Compound Name | 1-[2-(2,5-dimethylpyrrolidin-1-yl)ethyl]-4-(4-methyl-2-nitrophenyl)piperazine |
|---|---|
| PubChem CID | 133389453 |
| Molecular Formula | C19H30N4O2 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | 1-[2-(2,5-dimethylpyrrolidin-1-yl)ethyl]-4-(4-methyl-2-nitrophenyl)piperazine |
| SMILES | Cc1ccc(N2CCN(CCN3C(C)CCC3C)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H30N4O2/c1-15-4-7-18(19(14-15)23(24)25)21-11-8-20(9-12-21)10-13-22-16(2)5-6-17(22)3/h4,7,14,16-17H,5-6,8-13H2,1-3H3 |
| InChIKey | IXFSUWHHYYRNLV-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 52.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|