C18H23N3OS2 — CID 133389828
6-benzylsulfanyl-N-[(4-methylsulfanyloxan-4-yl)methyl]pyrazin-2-amine (PubChem CID 133389828) has the molecular formula C18H23N3OS2 and a molecular weight of 361.54 g/mol. Its IUPAC name is 6-benzylsulfanyl-N-[(4-methylsulfanyloxan-4-yl)methyl]pyrazin-2-amine.
| Compound Name | 6-benzylsulfanyl-N-[(4-methylsulfanyloxan-4-yl)methyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 133389828 |
| Molecular Formula | C18H23N3OS2 |
| Molecular Weight | 361.54 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 6-benzylsulfanyl-N-[(4-methylsulfanyloxan-4-yl)methyl]pyrazin-2-amine |
| SMILES | CSC1(CNc2cncc(SCc3ccccc3)n2)CCOCC1 |
| InChI | InChI=1S/C18H23N3OS2/c1-23-18(7-9-22-10-8-18)14-20-16-11-19-12-17(21-16)24-13-15-5-3-2-4-6-15/h2-6,11-12H,7-10,13-14H2,1H3,(H,20,21) |
| InChIKey | KLPYFAOKOIWJHN-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.54 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |