About 4-(aminomethyl)spiro[3H-chromene-2,1'-cyclopentane]-4-ol
4-(aminomethyl)spiro[3H-chromene-2,1'-cyclopentane]-4-ol (PubChem CID 13339036) has the molecular formula C14H19NO2
and a molecular weight of 233.31 g/mol. Its IUPAC name is 4-(aminomethyl)spiro[3H-chromene-2,1'-cyclopentane]-4-ol.
Molecular Properties
| Compound Name | 4-(aminomethyl)spiro[3H-chromene-2,1'-cyclopentane]-4-ol |
| PubChem CID | 13339036 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 4-(aminomethyl)spiro[3H-chromene-2,1'-cyclopentane]-4-ol |
| SMILES | NCC1(O)CC2(CCCC2)Oc2ccccc21 |
| InChI | InChI=1S/C14H19NO2/c15-10-14(16)9-13(7-3-4-8-13)17-12-6-2-1-5-11(12)14/h1-2,5-6,16H,3-4,7-10,15H2 |
| InChIKey | FPIULXBOQBEGLR-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(aminomethyl)spiro[3H-chromene-2,1'-cyclopentane]-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(aminomethyl)spiro[3H-chromene-2,1'-cyclopentane]-4-ol?
The IUPAC name of 4-(aminomethyl)spiro[3H-chromene-2,1'-cyclopentane]-4-ol (CID 13339036) is 4-(aminomethyl)spiro[3H-chromene-2,1'-cyclopentane]-4-ol.
What is the SMILES notation for 4-(aminomethyl)spiro[3H-chromene-2,1'-cyclopentane]-4-ol?
The canonical SMILES for 4-(aminomethyl)spiro[3H-chromene-2,1'-cyclopentane]-4-ol is NCC1(O)CC2(CCCC2)Oc2ccccc21.
What is the InChIKey of 4-(aminomethyl)spiro[3H-chromene-2,1'-cyclopentane]-4-ol?
The InChIKey is FPIULXBOQBEGLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO2/c15-10-14(16)9-13(7-3-4-8-13)17-12-6-2-1-5-11(12)14/h1-2,5-6,16H,3-4,7-10,15H2.
What are the key properties of 4-(aminomethyl)spiro[3H-chromene-2,1'-cyclopentane]-4-ol?
4-(aminomethyl)spiro[3H-chromene-2,1'-cyclopentane]-4-ol has a molecular weight of 233.31 g/mol, XLogP of 1.93, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(aminomethyl)spiro[3H-chromene-2,1'-cyclopentane]-4-ol is sourced from PubChem (CID 13339036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).