About 8-bromo-N-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]quinolin-2-amine
8-bromo-N-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]quinolin-2-amine (PubChem CID 133390364) has the molecular formula C16H17BrN2O
and a molecular weight of 333.23 g/mol. Its IUPAC name is 8-bromo-N-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]quinolin-2-amine.
Molecular Properties
| Compound Name | 8-bromo-N-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]quinolin-2-amine |
| PubChem CID | 133390364 |
| Molecular Formula | C16H17BrN2O |
| Molecular Weight | 333.23 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | 8-bromo-N-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]quinolin-2-amine |
| SMILES | Brc1cccc2ccc(NCCC3=CCOCC3)nc12 |
| InChI | InChI=1S/C16H17BrN2O/c17-14-3-1-2-13-4-5-15(19-16(13)14)18-9-6-12-7-10-20-11-8-12/h1-5,7H,6,8-11H2,(H,18,19) |
| InChIKey | SEVOYTDPJNHJQB-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.23 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 8-bromo-N-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]quinolin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-N-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]quinolin-2-amine?
The IUPAC name of 8-bromo-N-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]quinolin-2-amine (CID 133390364) is 8-bromo-N-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]quinolin-2-amine.
What is the SMILES notation for 8-bromo-N-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]quinolin-2-amine?
The canonical SMILES for 8-bromo-N-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]quinolin-2-amine is Brc1cccc2ccc(NCCC3=CCOCC3)nc12.
What is the InChIKey of 8-bromo-N-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]quinolin-2-amine?
The InChIKey is SEVOYTDPJNHJQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17BrN2O/c17-14-3-1-2-13-4-5-15(19-16(13)14)18-9-6-12-7-10-20-11-8-12/h1-5,7H,6,8-11H2,(H,18,19).
What are the key properties of 8-bromo-N-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]quinolin-2-amine?
8-bromo-N-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]quinolin-2-amine has a molecular weight of 333.23 g/mol, XLogP of 4.15, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-N-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]quinolin-2-amine is sourced from PubChem (CID 133390364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).